C22H40Cl2N6O6P2 — CID 5138034
N,N'-bis(2-chloro-2-dimorpholin-4-ylphosphorylethenyl)ethane-1,2-diamine (PubChem CID 5138034) has the molecular formula C22H40Cl2N6O6P2 and a molecular weight of 617.45 g/mol. Its IUPAC name is N,N'-bis(2-chloro-2-dimorpholin-4-ylphosphorylethenyl)ethane-1,2-diamine.
| Compound Name | N,N'-bis(2-chloro-2-dimorpholin-4-ylphosphorylethenyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 5138034 |
| Molecular Formula | C22H40Cl2N6O6P2 |
| Molecular Weight | 617.45 g/mol |
| Exact Mass | 616.19 |
| IUPAC Name | N,N'-bis(2-chloro-2-dimorpholin-4-ylphosphorylethenyl)ethane-1,2-diamine |
| SMILES | O=P(C(Cl)=CNCCNC=C(Cl)P(=O)(N1CCOCC1)N1CCOCC1)(N1CCOCC1)N1CCOCC1 |
| InChI | InChI=1S/C22H40Cl2N6O6P2/c23-21(37(31,27-3-11-33-12-4-27)28-5-13-34-14-6-28)19-25-1-2-26-20-22(24)38(32,29-7-15-35-16-8-29)30-9-17-36-18-10-30/h19-20,25-26H,1-18H2 |
| InChIKey | WWYHKLGWBFHCDP-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 108.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.45 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|