C23H23FN2O2 — CID 5138750
2-cyano-N-cyclohexyl-3-[4-[(3-fluorophenyl)methoxy]phenyl]prop-2-enamide (PubChem CID 5138750) has the molecular formula C23H23FN2O2 and a molecular weight of 378.45 g/mol. Its IUPAC name is 2-cyano-N-cyclohexyl-3-[4-[(3-fluorophenyl)methoxy]phenyl]prop-2-enamide.
| Compound Name | 2-cyano-N-cyclohexyl-3-[4-[(3-fluorophenyl)methoxy]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 5138750 |
| Molecular Formula | C23H23FN2O2 |
| Molecular Weight | 378.45 g/mol |
| Exact Mass | 378.17 |
| IUPAC Name | 2-cyano-N-cyclohexyl-3-[4-[(3-fluorophenyl)methoxy]phenyl]prop-2-enamide |
| SMILES | N#CC(=Cc1ccc(OCc2cccc(F)c2)cc1)C(=O)NC1CCCCC1 |
| InChI | InChI=1S/C23H23FN2O2/c24-20-6-4-5-18(14-20)16-28-22-11-9-17(10-12-22)13-19(15-25)23(27)26-21-7-2-1-3-8-21/h4-6,9-14,21H,1-3,7-8,16H2,(H,26,27) |
| InChIKey | GLOOVHOERRLVIG-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.45 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|