C11H18N2O5 — CID 51408502
3-[[(2R)-2,3-dihydroxypropyl]amino]-5,5-dimethyl-2-nitrocyclohex-2-en-1-one (PubChem CID 51408502) has the molecular formula C11H18N2O5 and a molecular weight of 258.27 g/mol. Its IUPAC name is 3-[[(2R)-2,3-dihydroxypropyl]amino]-5,5-dimethyl-2-nitrocyclohex-2-en-1-one.
| Compound Name | 3-[[(2R)-2,3-dihydroxypropyl]amino]-5,5-dimethyl-2-nitrocyclohex-2-en-1-one |
|---|---|
| PubChem CID | 51408502 |
| Molecular Formula | C11H18N2O5 |
| Molecular Weight | 258.27 g/mol |
| Exact Mass | 258.12 |
| IUPAC Name | 3-[[(2R)-2,3-dihydroxypropyl]amino]-5,5-dimethyl-2-nitrocyclohex-2-en-1-one |
| SMILES | CC1(C)CC(=O)C([N+](=O)[O-])=C(NC[C@@H](O)CO)C1 |
| InChI | InChI=1S/C11H18N2O5/c1-11(2)3-8(12-5-7(15)6-14)10(13(17)18)9(16)4-11/h7,12,14-15H,3-6H2,1-2H3/t7-/m1/s1 |
| InChIKey | MWWNDXGHGQLHDZ-SSDOTTSWSA-N |
| XLogP | -0.19 |
| TPSA | 112.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.27 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|