C15H21N3O3 — CID 5141201
[4-(hydroxyamino)-2,2,6,6-tetramethyl-3H-pyridin-1-yl] pyridine-2-carboxylate (PubChem CID 5141201) has the molecular formula C15H21N3O3 and a molecular weight of 291.35 g/mol. Its IUPAC name is [4-(hydroxyamino)-2,2,6,6-tetramethyl-3H-pyridin-1-yl] pyridine-2-carboxylate.
| Compound Name | [4-(hydroxyamino)-2,2,6,6-tetramethyl-3H-pyridin-1-yl] pyridine-2-carboxylate |
|---|---|
| PubChem CID | 5141201 |
| Molecular Formula | C15H21N3O3 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | [4-(hydroxyamino)-2,2,6,6-tetramethyl-3H-pyridin-1-yl] pyridine-2-carboxylate |
| SMILES | CC1(C)C=C(NO)CC(C)(C)N1OC(=O)c1ccccn1 |
| InChI | InChI=1S/C15H21N3O3/c1-14(2)9-11(17-20)10-15(3,4)18(14)21-13(19)12-7-5-6-8-16-12/h5-9,17,20H,10H2,1-4H3 |
| InChIKey | VRKLPAIOCAQOIC-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 74.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|