C17H19O- — CID 5144156
2-methyl-1,2-diphenylbutan-1-olate (PubChem CID 5144156) has the molecular formula C17H19O- and a molecular weight of 239.34 g/mol. Its IUPAC name is 2-methyl-1,2-diphenylbutan-1-olate.
| Compound Name | 2-methyl-1,2-diphenylbutan-1-olate |
|---|---|
| PubChem CID | 5144156 |
| Molecular Formula | C17H19O- |
| Molecular Weight | 239.34 g/mol |
| Exact Mass | 239.14 |
| IUPAC Name | 2-methyl-1,2-diphenylbutan-1-olate |
| SMILES | CCC(C)(c1ccccc1)C([O-])c1ccccc1 |
| InChI | InChI=1S/C17H19O/c1-3-17(2,15-12-8-5-9-13-15)16(18)14-10-6-4-7-11-14/h4-13,16H,3H2,1-2H3/q-1 |
| InChIKey | QHACIPGLFMXNGY-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 23.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.34 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |