C24H23N7O3S — CID 51529540
2-[4-[(Z)-[(4-amino-5-sulfanylidene-1H-1,2,4-triazol-3-yl)hydrazinylidene]methyl]-2-methoxyphenoxy]-N,N-diphenylacetamide (PubChem CID 51529540) has the molecular formula C24H23N7O3S and a molecular weight of 489.56 g/mol. Its IUPAC name is 2-[4-[(Z)-[(4-amino-5-sulfanylidene-1H-1,2,4-triazol-3-yl)hydrazinylidene]methyl]-2-methoxyphenoxy]-N,N-diphenylacetamide.
| Compound Name | 2-[4-[(Z)-[(4-amino-5-sulfanylidene-1H-1,2,4-triazol-3-yl)hydrazinylidene]methyl]-2-methoxyphenoxy]-N,N-diphenylacetamide |
|---|---|
| PubChem CID | 51529540 |
| Molecular Formula | C24H23N7O3S |
| Molecular Weight | 489.56 g/mol |
| Exact Mass | 489.16 |
| IUPAC Name | 2-[4-[(Z)-[(4-amino-5-sulfanylidene-1H-1,2,4-triazol-3-yl)hydrazinylidene]methyl]-2-methoxyphenoxy]-N,N-diphenylacetamide |
| SMILES | COc1cc(/C=N\Nc2n[nH]c(=S)n2N)ccc1OCC(=O)N(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H23N7O3S/c1-33-21-14-17(15-26-27-23-28-29-24(35)31(23)25)12-13-20(21)34-16-22(32)30(18-8-4-2-5-9-18)19-10-6-3-7-11-19/h2-15H,16,25H2,1H3,(H,27,28)(H,29,35)/b26-15- |
| InChIKey | ZVBNKLVKDRKTOI-YSMPRRRNSA-N |
| XLogP | 3.85 |
| TPSA | 122.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.56 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|