C42H56N2O2 — CID 515689
5-(4-propylpiperidin-1-yl)-1-[4-[5-(4-propylpiperidin-1-yl)pentanoyl]fluoranthen-8-yl]pentan-1-one (PubChem CID 515689) has the molecular formula C42H56N2O2 and a molecular weight of 620.92 g/mol. Its IUPAC name is 5-(4-propylpiperidin-1-yl)-1-[4-[5-(4-propylpiperidin-1-yl)pentanoyl]fluoranthen-8-yl]pentan-1-one.
| Compound Name | 5-(4-propylpiperidin-1-yl)-1-[4-[5-(4-propylpiperidin-1-yl)pentanoyl]fluoranthen-8-yl]pentan-1-one |
|---|---|
| PubChem CID | 515689 |
| Molecular Formula | C42H56N2O2 |
| Molecular Weight | 620.92 g/mol |
| Exact Mass | 620.43 |
| IUPAC Name | 5-(4-propylpiperidin-1-yl)-1-[4-[5-(4-propylpiperidin-1-yl)pentanoyl]fluoranthen-8-yl]pentan-1-one |
| SMILES | CCCC1CCN(CCCCC(=O)c2ccc3c(c2)-c2ccc(C(=O)CCCCN4CCC(CCC)CC4)c4cccc-3c24)CC1 |
| InChI | InChI=1S/C42H56N2O2/c1-3-10-31-20-26-43(27-21-31)24-7-5-14-40(45)33-16-17-34-36-12-9-13-37-35(18-19-38(42(36)37)39(34)30-33)41(46)15-6-8-25-44-28-22-32(11-4-2)23-29-44/h9,12-13,16-19,30-32H,3-8,10-11,14-15,20-29H2,1-2H3 |
| InChIKey | GJRYKPMCWUMKFY-UHFFFAOYSA-N |
| XLogP | 10.22 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.92 |
| LogP ≤ 5 | 10.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|