C42H52N2O2 — CID 515692
5-(3-azabicyclo[3.2.2]nonan-3-yl)-1-[4-[5-(3-azabicyclo[3.2.2]nonan-3-yl)pentanoyl]fluoranthen-8-yl]pentan-1-one (PubChem CID 515692) has the molecular formula C42H52N2O2 and a molecular weight of 616.89 g/mol. Its IUPAC name is 5-(3-azabicyclo[3.2.2]nonan-3-yl)-1-[4-[5-(3-azabicyclo[3.2.2]nonan-3-yl)pentanoyl]fluoranthen-8-yl]pentan-1-one.
| Compound Name | 5-(3-azabicyclo[3.2.2]nonan-3-yl)-1-[4-[5-(3-azabicyclo[3.2.2]nonan-3-yl)pentanoyl]fluoranthen-8-yl]pentan-1-one |
|---|---|
| PubChem CID | 515692 |
| Molecular Formula | C42H52N2O2 |
| Molecular Weight | 616.89 g/mol |
| Exact Mass | 616.40 |
| IUPAC Name | 5-(3-azabicyclo[3.2.2]nonan-3-yl)-1-[4-[5-(3-azabicyclo[3.2.2]nonan-3-yl)pentanoyl]fluoranthen-8-yl]pentan-1-one |
| SMILES | O=C(CCCCN1CC2CCC(CC2)C1)c1ccc2c(c1)-c1ccc(C(=O)CCCCN3CC4CCC(CC4)C3)c3cccc-2c13 |
| InChI | InChI=1S/C42H52N2O2/c45-40(8-1-3-22-43-25-29-10-11-30(26-43)13-12-29)33-18-19-34-36-6-5-7-37-35(20-21-38(42(36)37)39(34)24-33)41(46)9-2-4-23-44-27-31-14-15-32(28-44)17-16-31/h5-7,18-21,24,29-32H,1-4,8-17,22-23,25-28H2 |
| InChIKey | JNVASFOOAHHBMF-UHFFFAOYSA-N |
| XLogP | 9.44 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.89 |
| LogP ≤ 5 | 9.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|