C23H23Cl2N3O5 — CID 51600486
(3aS,7aR)-2-[[[(3aR,7aR)-5-chloro-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]methyl-(furan-2-ylmethyl)amino]methyl]-5-chloro-3a,4,7,7a-tetrahydroisoindole-1,3-dione (PubChem CID 51600486) has the molecular formula C23H23Cl2N3O5 and a molecular weight of 492.36 g/mol. Its IUPAC name is (3aS,7aR)-2-[[[(3aR,7aR)-5-chloro-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]methyl-(furan-2-ylmethyl)amino]methyl]-5-chloro-3a,4,7,7a-tetrahydroisoindole-1,3-dione.
| Compound Name | (3aS,7aR)-2-[[[(3aR,7aR)-5-chloro-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]methyl-(furan-2-ylmethyl)amino]methyl]-5-chloro-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 51600486 |
| Molecular Formula | C23H23Cl2N3O5 |
| Molecular Weight | 492.36 g/mol |
| Exact Mass | 491.10 |
| IUPAC Name | (3aS,7aR)-2-[[[(3aR,7aR)-5-chloro-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]methyl-(furan-2-ylmethyl)amino]methyl]-5-chloro-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
| SMILES | O=C1[C@H]2CC(Cl)=CC[C@H]2C(=O)N1CN(Cc1ccco1)CN1C(=O)[C@@H]2CC=C(Cl)C[C@H]2C1=O |
| InChI | InChI=1S/C23H23Cl2N3O5/c24-13-3-5-16-18(8-13)22(31)27(20(16)29)11-26(10-15-2-1-7-33-15)12-28-21(30)17-6-4-14(25)9-19(17)23(28)32/h1-4,7,16-19H,5-6,8-12H2/t16-,17-,18-,19+/m1/s1 |
| InChIKey | VMTOLTXHEHDERM-MKXGPGLRSA-N |
| XLogP | 3.03 |
| TPSA | 91.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.36 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|