C12H17Cl2NO4S — CID 5165118
2,4-dichloro-N-(1,1-dimethoxypropan-2-yl)-5-methylbenzenesulfonamide (PubChem CID 5165118) has the molecular formula C12H17Cl2NO4S and a molecular weight of 342.24 g/mol. Its IUPAC name is 2,4-dichloro-N-(1,1-dimethoxypropan-2-yl)-5-methylbenzenesulfonamide.
| Compound Name | 2,4-dichloro-N-(1,1-dimethoxypropan-2-yl)-5-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 5165118 |
| Molecular Formula | C12H17Cl2NO4S |
| Molecular Weight | 342.24 g/mol |
| Exact Mass | 341.03 |
| IUPAC Name | 2,4-dichloro-N-(1,1-dimethoxypropan-2-yl)-5-methylbenzenesulfonamide |
| SMILES | COC(OC)C(C)NS(=O)(=O)c1cc(C)c(Cl)cc1Cl |
| InChI | InChI=1S/C12H17Cl2NO4S/c1-7-5-11(10(14)6-9(7)13)20(16,17)15-8(2)12(18-3)19-4/h5-6,8,12,15H,1-4H3 |
| InChIKey | CEZFDSZSKNTETP-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.24 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|