C12H14N2O3S — CID 5165886
3,5-dimethyl-N-(4-methylphenyl)-1,2-oxazole-4-sulfonamide (PubChem CID 5165886) has the molecular formula C12H14N2O3S and a molecular weight of 266.32 g/mol. Its IUPAC name is 3,5-dimethyl-N-(4-methylphenyl)-1,2-oxazole-4-sulfonamide.
| Compound Name | 3,5-dimethyl-N-(4-methylphenyl)-1,2-oxazole-4-sulfonamide |
|---|---|
| PubChem CID | 5165886 |
| Molecular Formula | C12H14N2O3S |
| Molecular Weight | 266.32 g/mol |
| Exact Mass | 266.07 |
| IUPAC Name | 3,5-dimethyl-N-(4-methylphenyl)-1,2-oxazole-4-sulfonamide |
| SMILES | Cc1ccc(NS(=O)(=O)c2c(C)noc2C)cc1 |
| InChI | InChI=1S/C12H14N2O3S/c1-8-4-6-11(7-5-8)14-18(15,16)12-9(2)13-17-10(12)3/h4-7,14H,1-3H3 |
| InChIKey | YXYSUKGXZIOMHG-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.32 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |