C24H33N3O4S — CID 51672183
4-methoxy-N-[3-(N-methylanilino)propyl]-3-[(2R)-2-methylpiperidin-1-yl]sulfonylbenzamide (PubChem CID 51672183) has the molecular formula C24H33N3O4S and a molecular weight of 459.61 g/mol. Its IUPAC name is 4-methoxy-N-[3-(N-methylanilino)propyl]-3-[(2R)-2-methylpiperidin-1-yl]sulfonylbenzamide.
| Compound Name | 4-methoxy-N-[3-(N-methylanilino)propyl]-3-[(2R)-2-methylpiperidin-1-yl]sulfonylbenzamide |
|---|---|
| PubChem CID | 51672183 |
| Molecular Formula | C24H33N3O4S |
| Molecular Weight | 459.61 g/mol |
| Exact Mass | 459.22 |
| IUPAC Name | 4-methoxy-N-[3-(N-methylanilino)propyl]-3-[(2R)-2-methylpiperidin-1-yl]sulfonylbenzamide |
| SMILES | COc1ccc(C(=O)NCCCN(C)c2ccccc2)cc1S(=O)(=O)N1CCCC[C@H]1C |
| InChI | InChI=1S/C24H33N3O4S/c1-19-10-7-8-17-27(19)32(29,30)23-18-20(13-14-22(23)31-3)24(28)25-15-9-16-26(2)21-11-5-4-6-12-21/h4-6,11-14,18-19H,7-10,15-17H2,1-3H3,(H,25,28)/t19-/m1/s1 |
| InChIKey | RDLJVNXEDKKSJE-LJQANCHMSA-N |
| XLogP | 3.51 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.61 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|