C20H16N4O2 — CID 51682229
(4S,4aR)-2-amino-4-(1,3-benzodioxol-5-yl)-4a,5,6,7-tetrahydro-4H-naphthalene-1,3,3-tricarbonitrile (PubChem CID 51682229) has the molecular formula C20H16N4O2 and a molecular weight of 344.37 g/mol. Its IUPAC name is (4S,4aR)-2-amino-4-(1,3-benzodioxol-5-yl)-4a,5,6,7-tetrahydro-4H-naphthalene-1,3,3-tricarbonitrile.
| Compound Name | (4S,4aR)-2-amino-4-(1,3-benzodioxol-5-yl)-4a,5,6,7-tetrahydro-4H-naphthalene-1,3,3-tricarbonitrile |
|---|---|
| PubChem CID | 51682229 |
| Molecular Formula | C20H16N4O2 |
| Molecular Weight | 344.37 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | (4S,4aR)-2-amino-4-(1,3-benzodioxol-5-yl)-4a,5,6,7-tetrahydro-4H-naphthalene-1,3,3-tricarbonitrile |
| SMILES | N#CC1=C(N)C(C#N)(C#N)[C@H](c2ccc3c(c2)OCO3)[C@H]2CCCC=C12 |
| InChI | InChI=1S/C20H16N4O2/c21-8-15-13-3-1-2-4-14(13)18(20(9-22,10-23)19(15)24)12-5-6-16-17(7-12)26-11-25-16/h3,5-7,14,18H,1-2,4,11,24H2/t14-,18+/m0/s1 |
| InChIKey | LMOAEQHNEPYZAY-KBXCAEBGSA-N |
| XLogP | 3.01 |
| TPSA | 115.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.37 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_ene_amine_A(56)', 'substructure': 'N/A'} |
|---|