C18H23N3O5S — CID 51688443
dimethyl (5R,6R,7S,8S,9S)-9-hydroxy-9-methyl-7-phenyl-3-sulfanylidene-1,2,4-triazaspiro[4.5]decane-6,8-dicarboxylate (PubChem CID 51688443) has the molecular formula C18H23N3O5S and a molecular weight of 393.47 g/mol. Its IUPAC name is dimethyl (5R,6R,7S,8S,9S)-9-hydroxy-9-methyl-7-phenyl-3-sulfanylidene-1,2,4-triazaspiro[4.5]decane-6,8-dicarboxylate.
| Compound Name | dimethyl (5R,6R,7S,8S,9S)-9-hydroxy-9-methyl-7-phenyl-3-sulfanylidene-1,2,4-triazaspiro[4.5]decane-6,8-dicarboxylate |
|---|---|
| PubChem CID | 51688443 |
| Molecular Formula | C18H23N3O5S |
| Molecular Weight | 393.47 g/mol |
| Exact Mass | 393.14 |
| IUPAC Name | dimethyl (5R,6R,7S,8S,9S)-9-hydroxy-9-methyl-7-phenyl-3-sulfanylidene-1,2,4-triazaspiro[4.5]decane-6,8-dicarboxylate |
| SMILES | COC(=O)[C@@H]1[C@H](c2ccccc2)[C@H](C(=O)OC)[C@@](C)(O)C[C@@]12NNC(=S)N2 |
| InChI | InChI=1S/C18H23N3O5S/c1-17(24)9-18(19-16(27)20-21-18)13(15(23)26-3)11(12(17)14(22)25-2)10-7-5-4-6-8-10/h4-8,11-13,21,24H,9H2,1-3H3,(H2,19,20,27)/t11-,12-,13+,17+,18-/m1/s1 |
| InChIKey | JAOODCGAHPLYJW-AVKPWTQGSA-N |
| XLogP | 0.18 |
| TPSA | 108.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.47 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|