C9H10Cl2N2O3 — CID 51726383
1-[[(1S)-2,2-dichlorocyclopropyl]methyl]-3-ethylimidazolidine-2,4,5-trione (PubChem CID 51726383) has the molecular formula C9H10Cl2N2O3 and a molecular weight of 265.10 g/mol. Its IUPAC name is 1-[[(1S)-2,2-dichlorocyclopropyl]methyl]-3-ethylimidazolidine-2,4,5-trione.
| Compound Name | 1-[[(1S)-2,2-dichlorocyclopropyl]methyl]-3-ethylimidazolidine-2,4,5-trione |
|---|---|
| PubChem CID | 51726383 |
| Molecular Formula | C9H10Cl2N2O3 |
| Molecular Weight | 265.10 g/mol |
| Exact Mass | 264.01 |
| IUPAC Name | 1-[[(1S)-2,2-dichlorocyclopropyl]methyl]-3-ethylimidazolidine-2,4,5-trione |
| SMILES | CCN1C(=O)C(=O)N(C[C@@H]2CC2(Cl)Cl)C1=O |
| InChI | InChI=1S/C9H10Cl2N2O3/c1-2-12-6(14)7(15)13(8(12)16)4-5-3-9(5,10)11/h5H,2-4H2,1H3/t5-/m0/s1 |
| InChIKey | QCNKPZIKBXKMKG-YFKPBYRVSA-N |
| XLogP | 0.99 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.10 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|