C28H19ClN2O7S2 — CID 5191915
[1-[(9,10-dioxoanthracen-2-yl)amino]-1-oxopropan-2-yl] 2-[(5-chlorothiophen-2-yl)sulfonylamino]benzoate (PubChem CID 5191915) has the molecular formula C28H19ClN2O7S2 and a molecular weight of 595.05 g/mol. Its IUPAC name is [1-[(9,10-dioxoanthracen-2-yl)amino]-1-oxopropan-2-yl] 2-[(5-chlorothiophen-2-yl)sulfonylamino]benzoate.
| Compound Name | [1-[(9,10-dioxoanthracen-2-yl)amino]-1-oxopropan-2-yl] 2-[(5-chlorothiophen-2-yl)sulfonylamino]benzoate |
|---|---|
| PubChem CID | 5191915 |
| Molecular Formula | C28H19ClN2O7S2 |
| Molecular Weight | 595.05 g/mol |
| Exact Mass | 594.03 |
| IUPAC Name | [1-[(9,10-dioxoanthracen-2-yl)amino]-1-oxopropan-2-yl] 2-[(5-chlorothiophen-2-yl)sulfonylamino]benzoate |
| SMILES | CC(OC(=O)c1ccccc1NS(=O)(=O)c1ccc(Cl)s1)C(=O)Nc1ccc2c(c1)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C28H19ClN2O7S2/c1-15(38-28(35)20-8-4-5-9-22(20)31-40(36,37)24-13-12-23(29)39-24)27(34)30-16-10-11-19-21(14-16)26(33)18-7-3-2-6-17(18)25(19)32/h2-15,31H,1H3,(H,30,34) |
| InChIKey | RQCLSTYQLGVMIE-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 135.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.05 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|