C20H24N4O4 — CID 51926387
2-[(4S)-4-(furan-2-yl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-[3-(N-methylanilino)propyl]acetamide (PubChem CID 51926387) has the molecular formula C20H24N4O4 and a molecular weight of 384.44 g/mol. Its IUPAC name is 2-[(4S)-4-(furan-2-yl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-[3-(N-methylanilino)propyl]acetamide.
| Compound Name | 2-[(4S)-4-(furan-2-yl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-[3-(N-methylanilino)propyl]acetamide |
|---|---|
| PubChem CID | 51926387 |
| Molecular Formula | C20H24N4O4 |
| Molecular Weight | 384.44 g/mol |
| Exact Mass | 384.18 |
| IUPAC Name | 2-[(4S)-4-(furan-2-yl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-[3-(N-methylanilino)propyl]acetamide |
| SMILES | CN(CCCNC(=O)CN1C(=O)N[C@@](C)(c2ccco2)C1=O)c1ccccc1 |
| InChI | InChI=1S/C20H24N4O4/c1-20(16-10-6-13-28-16)18(26)24(19(27)22-20)14-17(25)21-11-7-12-23(2)15-8-4-3-5-9-15/h3-6,8-10,13H,7,11-12,14H2,1-2H3,(H,21,25)(H,22,27)/t20-/m0/s1 |
| InChIKey | UCFLMYPMHVQZRL-FQEVSTJZSA-N |
| XLogP | 1.69 |
| TPSA | 94.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.44 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|