C17H22N4O2S — CID 51935294
1-[[2-(2-methyl-1,3-thiazol-4-yl)acetyl]amino]-3-[(1S)-1-phenylbutyl]urea (PubChem CID 51935294) has the molecular formula C17H22N4O2S and a molecular weight of 346.46 g/mol. Its IUPAC name is 1-[[2-(2-methyl-1,3-thiazol-4-yl)acetyl]amino]-3-[(1S)-1-phenylbutyl]urea.
| Compound Name | 1-[[2-(2-methyl-1,3-thiazol-4-yl)acetyl]amino]-3-[(1S)-1-phenylbutyl]urea |
|---|---|
| PubChem CID | 51935294 |
| Molecular Formula | C17H22N4O2S |
| Molecular Weight | 346.46 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | 1-[[2-(2-methyl-1,3-thiazol-4-yl)acetyl]amino]-3-[(1S)-1-phenylbutyl]urea |
| SMILES | CCC[C@H](NC(=O)NNC(=O)Cc1csc(C)n1)c1ccccc1 |
| InChI | InChI=1S/C17H22N4O2S/c1-3-7-15(13-8-5-4-6-9-13)19-17(23)21-20-16(22)10-14-11-24-12(2)18-14/h4-6,8-9,11,15H,3,7,10H2,1-2H3,(H,20,22)(H2,19,21,23)/t15-/m0/s1 |
| InChIKey | PQMNEILXYRZIGB-HNNXBMFYSA-N |
| XLogP | 2.87 |
| TPSA | 83.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.46 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|