C18H19N3O7S — CID 51951066
cis-(1S,2R)-N-[4-methoxy-3-[(4-methoxyphenyl)sulfamoyl]phenyl]-2-nitrocyclopropane-1-carboxamide (PubChem CID 51951066) has the molecular formula C18H19N3O7S and a molecular weight of 421.43 g/mol. Its IUPAC name is cis-(1S,2R)-N-[4-methoxy-3-[(4-methoxyphenyl)sulfamoyl]phenyl]-2-nitrocyclopropane-1-carboxamide.
| Compound Name | cis-(1S,2R)-N-[4-methoxy-3-[(4-methoxyphenyl)sulfamoyl]phenyl]-2-nitrocyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 51951066 |
| Molecular Formula | C18H19N3O7S |
| Molecular Weight | 421.43 g/mol |
| Exact Mass | 421.09 |
| IUPAC Name | cis-(1S,2R)-N-[4-methoxy-3-[(4-methoxyphenyl)sulfamoyl]phenyl]-2-nitrocyclopropane-1-carboxamide |
| SMILES | COc1ccc(NS(=O)(=O)c2cc(NC(=O)[C@H]3C[C@H]3[N+](=O)[O-])ccc2OC)cc1 |
| InChI | InChI=1S/C18H19N3O7S/c1-27-13-6-3-11(4-7-13)20-29(25,26)17-9-12(5-8-16(17)28-2)19-18(22)14-10-15(14)21(23)24/h3-9,14-15,20H,10H2,1-2H3,(H,19,22)/t14-,15+/m0/s1 |
| InChIKey | UNHZZMSAVICITL-LSDHHAIUSA-N |
| XLogP | 2.11 |
| TPSA | 136.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.43 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|