C23H34N4O5S — CID 51960282
tert-butyl (2R)-2-[[3-[(1-methylazepan-2-ylidene)amino]sulfonylphenyl]carbamoyl]pyrrolidine-1-carboxylate (PubChem CID 51960282) has the molecular formula C23H34N4O5S and a molecular weight of 478.62 g/mol. Its IUPAC name is tert-butyl (2R)-2-[[3-[(1-methylazepan-2-ylidene)amino]sulfonylphenyl]carbamoyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2R)-2-[[3-[(1-methylazepan-2-ylidene)amino]sulfonylphenyl]carbamoyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 51960282 |
| Molecular Formula | C23H34N4O5S |
| Molecular Weight | 478.62 g/mol |
| Exact Mass | 478.22 |
| IUPAC Name | tert-butyl (2R)-2-[[3-[(1-methylazepan-2-ylidene)amino]sulfonylphenyl]carbamoyl]pyrrolidine-1-carboxylate |
| SMILES | CN1CCCCCC1=NS(=O)(=O)c1cccc(NC(=O)[C@H]2CCCN2C(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C23H34N4O5S/c1-23(2,3)32-22(29)27-15-9-12-19(27)21(28)24-17-10-8-11-18(16-17)33(30,31)25-20-13-6-5-7-14-26(20)4/h8,10-11,16,19H,5-7,9,12-15H2,1-4H3,(H,24,28)/t19-/m1/s1 |
| InChIKey | XFCOATICOXORSD-LJQANCHMSA-N |
| XLogP | 3.62 |
| TPSA | 108.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.62 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|