C23H26FN3O3S — CID 60549670
2-(2-fluorophenyl)-N-[3-[(E)-(1-methylazepan-2-ylidene)amino]sulfonylphenyl]cyclopropane-1-carboxamide (PubChem CID 60549670) has the molecular formula C23H26FN3O3S and a molecular weight of 443.54 g/mol. Its IUPAC name is 2-(2-fluorophenyl)-N-[3-[(E)-(1-methylazepan-2-ylidene)amino]sulfonylphenyl]cyclopropane-1-carboxamide.
| Compound Name | 2-(2-fluorophenyl)-N-[3-[(E)-(1-methylazepan-2-ylidene)amino]sulfonylphenyl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 60549670 |
| Molecular Formula | C23H26FN3O3S |
| Molecular Weight | 443.54 g/mol |
| Exact Mass | 443.17 |
| IUPAC Name | 2-(2-fluorophenyl)-N-[3-[(E)-(1-methylazepan-2-ylidene)amino]sulfonylphenyl]cyclopropane-1-carboxamide |
| SMILES | CN1CCCCC/C1=N\S(=O)(=O)c1cccc(NC(=O)C2CC2c2ccccc2F)c1 |
| InChI | InChI=1S/C23H26FN3O3S/c1-27-13-6-2-3-12-22(27)26-31(29,30)17-9-7-8-16(14-17)25-23(28)20-15-19(20)18-10-4-5-11-21(18)24/h4-5,7-11,14,19-20H,2-3,6,12-13,15H2,1H3,(H,25,28)/b26-22+ |
| InChIKey | YQCMLFRQKAFSBC-XTCLZLMSSA-N |
| XLogP | 4.16 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.54 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|