C17H10Cl2FN3S — CID 5208796
2-[(2,6-dichlorophenyl)methylsulfanyl-(4-fluoroanilino)methylidene]propanedinitrile (PubChem CID 5208796) has the molecular formula C17H10Cl2FN3S and a molecular weight of 378.26 g/mol. Its IUPAC name is 2-[(2,6-dichlorophenyl)methylsulfanyl-(4-fluoroanilino)methylidene]propanedinitrile.
| Compound Name | 2-[(2,6-dichlorophenyl)methylsulfanyl-(4-fluoroanilino)methylidene]propanedinitrile |
|---|---|
| PubChem CID | 5208796 |
| Molecular Formula | C17H10Cl2FN3S |
| Molecular Weight | 378.26 g/mol |
| Exact Mass | 377.00 |
| IUPAC Name | 2-[(2,6-dichlorophenyl)methylsulfanyl-(4-fluoroanilino)methylidene]propanedinitrile |
| SMILES | N#CC(C#N)=C(Nc1ccc(F)cc1)SCc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C17H10Cl2FN3S/c18-15-2-1-3-16(19)14(15)10-24-17(11(8-21)9-22)23-13-6-4-12(20)5-7-13/h1-7,23H,10H2 |
| InChIKey | IGYPXQNZOQKKOD-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 59.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.26 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|