C7H5ClN4S — CID 5211550
1-(5-chlorothiophen-2-yl)-N-(1,2,4-triazol-4-yl)methanimine (PubChem CID 5211550) has the molecular formula C7H5ClN4S and a molecular weight of 212.67 g/mol. Its IUPAC name is 1-(5-chlorothiophen-2-yl)-N-(1,2,4-triazol-4-yl)methanimine.
| Compound Name | 1-(5-chlorothiophen-2-yl)-N-(1,2,4-triazol-4-yl)methanimine |
|---|---|
| PubChem CID | 5211550 |
| Molecular Formula | C7H5ClN4S |
| Molecular Weight | 212.67 g/mol |
| Exact Mass | 211.99 |
| IUPAC Name | 1-(5-chlorothiophen-2-yl)-N-(1,2,4-triazol-4-yl)methanimine |
| SMILES | Clc1ccc(C=Nn2cnnc2)s1 |
| InChI | InChI=1S/C7H5ClN4S/c8-7-2-1-6(13-7)3-11-12-4-9-10-5-12/h1-5H |
| InChIKey | BXEFCOTWYFZNIW-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 43.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.67 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|