C8H5ClN6S — CID 167808660
(E)-1-(5-chloroimidazo[2,1-b][1,3]thiazol-6-yl)-N-(1,2,4-triazol-4-yl)methanimine (PubChem CID 167808660) has the molecular formula C8H5ClN6S and a molecular weight of 252.69 g/mol. Its IUPAC name is (E)-1-(5-chloroimidazo[2,1-b][1,3]thiazol-6-yl)-N-(1,2,4-triazol-4-yl)methanimine.
| Compound Name | (E)-1-(5-chloroimidazo[2,1-b][1,3]thiazol-6-yl)-N-(1,2,4-triazol-4-yl)methanimine |
|---|---|
| PubChem CID | 167808660 |
| Molecular Formula | C8H5ClN6S |
| Molecular Weight | 252.69 g/mol |
| Exact Mass | 252.00 |
| IUPAC Name | (E)-1-(5-chloroimidazo[2,1-b][1,3]thiazol-6-yl)-N-(1,2,4-triazol-4-yl)methanimine |
| SMILES | Clc1c(/C=N/n2cnnc2)nc2sccn12 |
| InChI | InChI=1S/C8H5ClN6S/c9-7-6(3-12-14-4-10-11-5-14)13-8-15(7)1-2-16-8/h1-5H/b12-3+ |
| InChIKey | RJGZEXAWTPDSKA-KGVSQERTSA-N |
| XLogP | 1.52 |
| TPSA | 60.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.69 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|