C19H32N2O2 — CID 5215461
1-(cyclohex-3-en-1-ylmethyl)-1-(cyclohexylmethyl)-3-(oxolan-2-yl)urea (PubChem CID 5215461) has the molecular formula C19H32N2O2 and a molecular weight of 320.48 g/mol. Its IUPAC name is 1-(cyclohex-3-en-1-ylmethyl)-1-(cyclohexylmethyl)-3-(oxolan-2-yl)urea.
| Compound Name | 1-(cyclohex-3-en-1-ylmethyl)-1-(cyclohexylmethyl)-3-(oxolan-2-yl)urea |
|---|---|
| PubChem CID | 5215461 |
| Molecular Formula | C19H32N2O2 |
| Molecular Weight | 320.48 g/mol |
| Exact Mass | 320.25 |
| IUPAC Name | 1-(cyclohex-3-en-1-ylmethyl)-1-(cyclohexylmethyl)-3-(oxolan-2-yl)urea |
| SMILES | O=C(NC1CCCO1)N(CC1CC=CCC1)CC1CCCCC1 |
| InChI | InChI=1S/C19H32N2O2/c22-19(20-18-12-7-13-23-18)21(14-16-8-3-1-4-9-16)15-17-10-5-2-6-11-17/h1,3,16-18H,2,4-15H2,(H,20,22) |
| InChIKey | GLSAFCWACNLYPB-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.48 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|