About trimethylsilyl nonanoate
trimethylsilyl nonanoate (PubChem CID 522774) has the molecular formula C12H26O2Si
and a molecular weight of 230.42 g/mol. Its IUPAC name is trimethylsilyl nonanoate.
Molecular Properties
| Compound Name | trimethylsilyl nonanoate |
| PubChem CID | 522774 |
| Molecular Formula | C12H26O2Si |
| Molecular Weight | 230.42 g/mol |
| Exact Mass | 230.17 |
| IUPAC Name | trimethylsilyl nonanoate |
| SMILES | CCCCCCCCC(=O)O[Si](C)(C)C |
| InChI | InChI=1S/C12H26O2Si/c1-5-6-7-8-9-10-11-12(13)14-15(2,3)4/h5-11H2,1-4H3 |
| InChIKey | ISTGUORKGWWKMI-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.42 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze trimethylsilyl nonanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trimethylsilyl nonanoate?
The IUPAC name of trimethylsilyl nonanoate (CID 522774) is trimethylsilyl nonanoate.
What is the SMILES notation for trimethylsilyl nonanoate?
The canonical SMILES for trimethylsilyl nonanoate is CCCCCCCCC(=O)O[Si](C)(C)C.
What is the InChIKey of trimethylsilyl nonanoate?
The InChIKey is ISTGUORKGWWKMI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H26O2Si/c1-5-6-7-8-9-10-11-12(13)14-15(2,3)4/h5-11H2,1-4H3.
What are the key properties of trimethylsilyl nonanoate?
trimethylsilyl nonanoate has a molecular weight of 230.42 g/mol, XLogP of 4.12, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for trimethylsilyl nonanoate is sourced from PubChem (CID 522774), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).