C11H17N — CID 5232413
4-cyclohexyl-1,2-dihydropyridine (PubChem CID 5232413) has the molecular formula C11H17N and a molecular weight of 163.26 g/mol. Its IUPAC name is 4-cyclohexyl-1,2-dihydropyridine.
| Compound Name | 4-cyclohexyl-1,2-dihydropyridine |
|---|---|
| PubChem CID | 5232413 |
| Molecular Formula | C11H17N |
| Molecular Weight | 163.26 g/mol |
| Exact Mass | 163.14 |
| IUPAC Name | 4-cyclohexyl-1,2-dihydropyridine |
| SMILES | C1=CC(C2CCCCC2)=CCN1 |
| InChI | InChI=1S/C11H17N/c1-2-4-10(5-3-1)11-6-8-12-9-7-11/h6-8,10,12H,1-5,9H2 |
| InChIKey | QIJVMEWKXZDWFI-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.26 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |