C16H26N4 — CID 5232464
N-[2-[1-(1,2-dihydropyridin-4-yl)ethylideneamino]ethyl]-1-piperidin-4-ylethanimine (PubChem CID 5232464) has the molecular formula C16H26N4 and a molecular weight of 274.41 g/mol. Its IUPAC name is N-[2-[1-(1,2-dihydropyridin-4-yl)ethylideneamino]ethyl]-1-piperidin-4-ylethanimine.
| Compound Name | N-[2-[1-(1,2-dihydropyridin-4-yl)ethylideneamino]ethyl]-1-piperidin-4-ylethanimine |
|---|---|
| PubChem CID | 5232464 |
| Molecular Formula | C16H26N4 |
| Molecular Weight | 274.41 g/mol |
| Exact Mass | 274.22 |
| IUPAC Name | N-[2-[1-(1,2-dihydropyridin-4-yl)ethylideneamino]ethyl]-1-piperidin-4-ylethanimine |
| SMILES | C/C(=N\CC/N=C(\C)C1CCNCC1)C1=CCNC=C1 |
| InChI | InChI=1S/C16H26N4/c1-13(15-3-7-17-8-4-15)19-11-12-20-14(2)16-5-9-18-10-6-16/h3-4,7,16-18H,5-6,8-12H2,1-2H3/b19-13+,20-14+ |
| InChIKey | NUQLEZXZOZORRE-IWGRKNQJSA-N |
| XLogP | 1.95 |
| TPSA | 48.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.41 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|