About silver;3,6-dihydro-2H-pyridin-1-ide;piperidin-1-ide
silver;3,6-dihydro-2H-pyridin-1-ide;piperidin-1-ide (PubChem CID 5234611) has the molecular formula C10H18AgN2-
and a molecular weight of 274.14 g/mol. Its IUPAC name is silver;3,6-dihydro-2H-pyridin-1-ide;piperidin-1-ide.
Molecular Properties
| Compound Name | silver;3,6-dihydro-2H-pyridin-1-ide;piperidin-1-ide |
| PubChem CID | 5234611 |
| Molecular Formula | C10H18AgN2- |
| Molecular Weight | 274.14 g/mol |
| Exact Mass | 273.05 |
| IUPAC Name | silver;3,6-dihydro-2H-pyridin-1-ide;piperidin-1-ide |
| SMILES | C1=CC[N-]CC1.C1CC[N-]CC1.[Ag+] |
| InChI | InChI=1S/C5H10N.C5H8N.Ag/c2*1-2-4-6-5-3-1;/h1-5H2;1-2H,3-5H2;/q2*-1;+1 |
| InChIKey | CKSWDDDZRONLSO-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 28.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.14 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze silver;3,6-dihydro-2H-pyridin-1-ide;piperidin-1-ide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of silver;3,6-dihydro-2H-pyridin-1-ide;piperidin-1-ide?
The IUPAC name of silver;3,6-dihydro-2H-pyridin-1-ide;piperidin-1-ide (CID 5234611) is silver;3,6-dihydro-2H-pyridin-1-ide;piperidin-1-ide.
What is the SMILES notation for silver;3,6-dihydro-2H-pyridin-1-ide;piperidin-1-ide?
The canonical SMILES for silver;3,6-dihydro-2H-pyridin-1-ide;piperidin-1-ide is C1=CC[N-]CC1.C1CC[N-]CC1.[Ag+].
What is the InChIKey of silver;3,6-dihydro-2H-pyridin-1-ide;piperidin-1-ide?
The InChIKey is CKSWDDDZRONLSO-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10N.C5H8N.Ag/c2*1-2-4-6-5-3-1;/h1-5H2;1-2H,3-5H2;/q2*-1;+1.
What are the key properties of silver;3,6-dihydro-2H-pyridin-1-ide;piperidin-1-ide?
silver;3,6-dihydro-2H-pyridin-1-ide;piperidin-1-ide has a molecular weight of 274.14 g/mol, XLogP of 2.86, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for silver;3,6-dihydro-2H-pyridin-1-ide;piperidin-1-ide is sourced from PubChem (CID 5234611), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).