C18H13N3O4 — CID 5239203
3-[3-(benzimidazol-1-yl)-2,5-dioxopyrrolidin-1-yl]benzoic acid (PubChem CID 5239203) has the molecular formula C18H13N3O4 and a molecular weight of 335.32 g/mol. Its IUPAC name is 3-[3-(benzimidazol-1-yl)-2,5-dioxopyrrolidin-1-yl]benzoic acid.
| Compound Name | 3-[3-(benzimidazol-1-yl)-2,5-dioxopyrrolidin-1-yl]benzoic acid |
|---|---|
| PubChem CID | 5239203 |
| Molecular Formula | C18H13N3O4 |
| Molecular Weight | 335.32 g/mol |
| Exact Mass | 335.09 |
| IUPAC Name | 3-[3-(benzimidazol-1-yl)-2,5-dioxopyrrolidin-1-yl]benzoic acid |
| SMILES | O=C(O)c1cccc(N2C(=O)CC(n3cnc4ccccc43)C2=O)c1 |
| InChI | InChI=1S/C18H13N3O4/c22-16-9-15(20-10-19-13-6-1-2-7-14(13)20)17(23)21(16)12-5-3-4-11(8-12)18(24)25/h1-8,10,15H,9H2,(H,24,25) |
| InChIKey | HMNADRURGUTBSE-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.32 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|