C18H12N3O4- — CID 6988076
4-[(3R)-3-(benzimidazol-1-yl)-2,5-dioxopyrrolidin-1-yl]benzoate (PubChem CID 6988076) has the molecular formula C18H12N3O4- and a molecular weight of 334.31 g/mol. Its IUPAC name is 4-[(3R)-3-(benzimidazol-1-yl)-2,5-dioxopyrrolidin-1-yl]benzoate.
| Compound Name | 4-[(3R)-3-(benzimidazol-1-yl)-2,5-dioxopyrrolidin-1-yl]benzoate |
|---|---|
| PubChem CID | 6988076 |
| Molecular Formula | C18H12N3O4- |
| Molecular Weight | 334.31 g/mol |
| Exact Mass | 334.08 |
| IUPAC Name | 4-[(3R)-3-(benzimidazol-1-yl)-2,5-dioxopyrrolidin-1-yl]benzoate |
| SMILES | O=C([O-])c1ccc(N2C(=O)C[C@@H](n3cnc4ccccc43)C2=O)cc1 |
| InChI | InChI=1S/C18H13N3O4/c22-16-9-15(20-10-19-13-3-1-2-4-14(13)20)17(23)21(16)12-7-5-11(6-8-12)18(24)25/h1-8,10,15H,9H2,(H,24,25)/p-1/t15-/m1/s1 |
| InChIKey | JJWKVXMKBKOFIF-OAHLLOKOSA-M |
| XLogP | 0.90 |
| TPSA | 95.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.31 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|