C19H26N2O5 — CID 52510455
(2S)-2-(3,5-dimethyl-1,2-oxazol-4-yl)-N-[4-methoxy-3-(2-methoxyethoxy)phenyl]butanamide (PubChem CID 52510455) has the molecular formula C19H26N2O5 and a molecular weight of 362.43 g/mol. Its IUPAC name is (2S)-2-(3,5-dimethyl-1,2-oxazol-4-yl)-N-[4-methoxy-3-(2-methoxyethoxy)phenyl]butanamide.
| Compound Name | (2S)-2-(3,5-dimethyl-1,2-oxazol-4-yl)-N-[4-methoxy-3-(2-methoxyethoxy)phenyl]butanamide |
|---|---|
| PubChem CID | 52510455 |
| Molecular Formula | C19H26N2O5 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.18 |
| IUPAC Name | (2S)-2-(3,5-dimethyl-1,2-oxazol-4-yl)-N-[4-methoxy-3-(2-methoxyethoxy)phenyl]butanamide |
| SMILES | CC[C@H](C(=O)Nc1ccc(OC)c(OCCOC)c1)c1c(C)noc1C |
| InChI | InChI=1S/C19H26N2O5/c1-6-15(18-12(2)21-26-13(18)3)19(22)20-14-7-8-16(24-5)17(11-14)25-10-9-23-4/h7-8,11,15H,6,9-10H2,1-5H3,(H,20,22)/t15-/m0/s1 |
| InChIKey | QSNKEXICYJEQRO-HNNXBMFYSA-N |
| XLogP | 3.46 |
| TPSA | 82.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|