C18H30N2O4 — CID 95198688
1-ethyl-3-[4-methoxy-3-(2-methoxyethoxy)phenyl]-1-[(2S)-3-methylbutan-2-yl]urea (PubChem CID 95198688) has the molecular formula C18H30N2O4 and a molecular weight of 338.45 g/mol. Its IUPAC name is 1-ethyl-3-[4-methoxy-3-(2-methoxyethoxy)phenyl]-1-[(2S)-3-methylbutan-2-yl]urea.
| Compound Name | 1-ethyl-3-[4-methoxy-3-(2-methoxyethoxy)phenyl]-1-[(2S)-3-methylbutan-2-yl]urea |
|---|---|
| PubChem CID | 95198688 |
| Molecular Formula | C18H30N2O4 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.22 |
| IUPAC Name | 1-ethyl-3-[4-methoxy-3-(2-methoxyethoxy)phenyl]-1-[(2S)-3-methylbutan-2-yl]urea |
| SMILES | CCN(C(=O)Nc1ccc(OC)c(OCCOC)c1)[C@@H](C)C(C)C |
| InChI | InChI=1S/C18H30N2O4/c1-7-20(14(4)13(2)3)18(21)19-15-8-9-16(23-6)17(12-15)24-11-10-22-5/h8-9,12-14H,7,10-11H2,1-6H3,(H,19,21)/t14-/m0/s1 |
| InChIKey | GQFIIEIEKWJFTK-AWEZNQCLSA-N |
| XLogP | 3.62 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|