C19H21N3O4 — CID 52537486
(2S,4R)-1-[(2-methoxy-5-nitrophenyl)methyl]-2-methyl-3,4-dihydro-2H-quinoline-4-carboxamide (PubChem CID 52537486) has the molecular formula C19H21N3O4 and a molecular weight of 355.39 g/mol. Its IUPAC name is (2S,4R)-1-[(2-methoxy-5-nitrophenyl)methyl]-2-methyl-3,4-dihydro-2H-quinoline-4-carboxamide.
| Compound Name | (2S,4R)-1-[(2-methoxy-5-nitrophenyl)methyl]-2-methyl-3,4-dihydro-2H-quinoline-4-carboxamide |
|---|---|
| PubChem CID | 52537486 |
| Molecular Formula | C19H21N3O4 |
| Molecular Weight | 355.39 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | (2S,4R)-1-[(2-methoxy-5-nitrophenyl)methyl]-2-methyl-3,4-dihydro-2H-quinoline-4-carboxamide |
| SMILES | COc1ccc([N+](=O)[O-])cc1CN1c2ccccc2[C@H](C(N)=O)C[C@@H]1C |
| InChI | InChI=1S/C19H21N3O4/c1-12-9-16(19(20)23)15-5-3-4-6-17(15)21(12)11-13-10-14(22(24)25)7-8-18(13)26-2/h3-8,10,12,16H,9,11H2,1-2H3,(H2,20,23)/t12-,16+/m0/s1 |
| InChIKey | BDHYBMIDMIUTTA-BLLLJJGKSA-N |
| XLogP | 2.97 |
| TPSA | 98.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.39 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|