C8H14N2O2S — CID 5254752
4-acetyl-N-methylthiomorpholine-3-carboxamide (PubChem CID 5254752) has the molecular formula C8H14N2O2S and a molecular weight of 202.28 g/mol. Its IUPAC name is 4-acetyl-N-methylthiomorpholine-3-carboxamide.
| Compound Name | 4-acetyl-N-methylthiomorpholine-3-carboxamide |
|---|---|
| PubChem CID | 5254752 |
| Molecular Formula | C8H14N2O2S |
| Molecular Weight | 202.28 g/mol |
| Exact Mass | 202.08 |
| IUPAC Name | 4-acetyl-N-methylthiomorpholine-3-carboxamide |
| SMILES | CNC(=O)C1CSCCN1C(C)=O |
| InChI | InChI=1S/C8H14N2O2S/c1-6(11)10-3-4-13-5-7(10)8(12)9-2/h7H,3-5H2,1-2H3,(H,9,12) |
| InChIKey | ZYRHPLXXKTYNII-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.28 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |