C20H40O8Si — CID 5255891
4-[2-[tert-butyl(dimethyl)silyl]oxy-4-hydroxy-3-(2-methoxyethoxymethoxy)-3-methylbutyl]-5-(hydroxymethyl)oxolan-2-one (PubChem CID 5255891) has the molecular formula C20H40O8Si and a molecular weight of 436.62 g/mol. Its IUPAC name is 4-[2-[tert-butyl(dimethyl)silyl]oxy-4-hydroxy-3-(2-methoxyethoxymethoxy)-3-methylbutyl]-5-(hydroxymethyl)oxolan-2-one.
| Compound Name | 4-[2-[tert-butyl(dimethyl)silyl]oxy-4-hydroxy-3-(2-methoxyethoxymethoxy)-3-methylbutyl]-5-(hydroxymethyl)oxolan-2-one |
|---|---|
| PubChem CID | 5255891 |
| Molecular Formula | C20H40O8Si |
| Molecular Weight | 436.62 g/mol |
| Exact Mass | 436.25 |
| IUPAC Name | 4-[2-[tert-butyl(dimethyl)silyl]oxy-4-hydroxy-3-(2-methoxyethoxymethoxy)-3-methylbutyl]-5-(hydroxymethyl)oxolan-2-one |
| SMILES | COCCOCOC(C)(CO)C(CC1CC(=O)OC1CO)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H40O8Si/c1-19(2,3)29(6,7)28-17(10-15-11-18(23)27-16(15)12-21)20(4,13-22)26-14-25-9-8-24-5/h15-17,21-22H,8-14H2,1-7H3 |
| InChIKey | JIIISPSFWIXOFL-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 103.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.62 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|