C15H15FINO4S — CID 52575608
2-fluoro-N-(4-iodo-2-methylphenyl)-4,5-dimethoxybenzenesulfonamide (PubChem CID 52575608) has the molecular formula C15H15FINO4S and a molecular weight of 451.26 g/mol. Its IUPAC name is 2-fluoro-N-(4-iodo-2-methylphenyl)-4,5-dimethoxybenzenesulfonamide.
| Compound Name | 2-fluoro-N-(4-iodo-2-methylphenyl)-4,5-dimethoxybenzenesulfonamide |
|---|---|
| PubChem CID | 52575608 |
| Molecular Formula | C15H15FINO4S |
| Molecular Weight | 451.26 g/mol |
| Exact Mass | 450.98 |
| IUPAC Name | 2-fluoro-N-(4-iodo-2-methylphenyl)-4,5-dimethoxybenzenesulfonamide |
| SMILES | COc1cc(F)c(S(=O)(=O)Nc2ccc(I)cc2C)cc1OC |
| InChI | InChI=1S/C15H15FINO4S/c1-9-6-10(17)4-5-12(9)18-23(19,20)15-8-14(22-3)13(21-2)7-11(15)16/h4-8,18H,1-3H3 |
| InChIKey | QABHZUGTKHKSBA-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.26 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|