C18H20F3NO3S — CID 52679215
N-[[2-(propoxymethyl)phenyl]methyl]-2-(trifluoromethylsulfonyl)aniline (PubChem CID 52679215) has the molecular formula C18H20F3NO3S and a molecular weight of 387.42 g/mol. Its IUPAC name is N-[[2-(propoxymethyl)phenyl]methyl]-2-(trifluoromethylsulfonyl)aniline.
| Compound Name | N-[[2-(propoxymethyl)phenyl]methyl]-2-(trifluoromethylsulfonyl)aniline |
|---|---|
| PubChem CID | 52679215 |
| Molecular Formula | C18H20F3NO3S |
| Molecular Weight | 387.42 g/mol |
| Exact Mass | 387.11 |
| IUPAC Name | N-[[2-(propoxymethyl)phenyl]methyl]-2-(trifluoromethylsulfonyl)aniline |
| SMILES | CCCOCc1ccccc1CNc1ccccc1S(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C18H20F3NO3S/c1-2-11-25-13-15-8-4-3-7-14(15)12-22-16-9-5-6-10-17(16)26(23,24)18(19,20)21/h3-10,22H,2,11-13H2,1H3 |
| InChIKey | XHUAJCZSQIFOCQ-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.42 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|