C25H29NO4S — CID 5268811
[4-(3-hydroxyanilino)-2,6-di(propan-2-yl)phenyl] 4-methylbenzenesulfonate (PubChem CID 5268811) has the molecular formula C25H29NO4S and a molecular weight of 439.58 g/mol. Its IUPAC name is [4-(3-hydroxyanilino)-2,6-di(propan-2-yl)phenyl] 4-methylbenzenesulfonate.
| Compound Name | [4-(3-hydroxyanilino)-2,6-di(propan-2-yl)phenyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 5268811 |
| Molecular Formula | C25H29NO4S |
| Molecular Weight | 439.58 g/mol |
| Exact Mass | 439.18 |
| IUPAC Name | [4-(3-hydroxyanilino)-2,6-di(propan-2-yl)phenyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)Oc2c(C(C)C)cc(Nc3cccc(O)c3)cc2C(C)C)cc1 |
| InChI | InChI=1S/C25H29NO4S/c1-16(2)23-14-20(26-19-7-6-8-21(27)13-19)15-24(17(3)4)25(23)30-31(28,29)22-11-9-18(5)10-12-22/h6-17,26-27H,1-5H3 |
| InChIKey | YCSBTTSGNRYMLJ-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.58 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|