C20H24ClN3O3S — CID 52702916
2-chloro-5-[3-(4-cyanophenoxy)propylamino]-N,N-diethylbenzenesulfonamide (PubChem CID 52702916) has the molecular formula C20H24ClN3O3S and a molecular weight of 421.95 g/mol. Its IUPAC name is 2-chloro-5-[3-(4-cyanophenoxy)propylamino]-N,N-diethylbenzenesulfonamide.
| Compound Name | 2-chloro-5-[3-(4-cyanophenoxy)propylamino]-N,N-diethylbenzenesulfonamide |
|---|---|
| PubChem CID | 52702916 |
| Molecular Formula | C20H24ClN3O3S |
| Molecular Weight | 421.95 g/mol |
| Exact Mass | 421.12 |
| IUPAC Name | 2-chloro-5-[3-(4-cyanophenoxy)propylamino]-N,N-diethylbenzenesulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1cc(NCCCOc2ccc(C#N)cc2)ccc1Cl |
| InChI | InChI=1S/C20H24ClN3O3S/c1-3-24(4-2)28(25,26)20-14-17(8-11-19(20)21)23-12-5-13-27-18-9-6-16(15-22)7-10-18/h6-11,14,23H,3-5,12-13H2,1-2H3 |
| InChIKey | FYDAZTCXJZMCKV-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 82.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.95 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|