C19H28N4OS — CID 5272480
N-[4-(2-amino-1,3-thiazol-4-yl)phenyl]-3-(heptan-4-ylamino)propanamide (PubChem CID 5272480) has the molecular formula C19H28N4OS and a molecular weight of 360.53 g/mol. Its IUPAC name is N-[4-(2-amino-1,3-thiazol-4-yl)phenyl]-3-(heptan-4-ylamino)propanamide.
| Compound Name | N-[4-(2-amino-1,3-thiazol-4-yl)phenyl]-3-(heptan-4-ylamino)propanamide |
|---|---|
| PubChem CID | 5272480 |
| Molecular Formula | C19H28N4OS |
| Molecular Weight | 360.53 g/mol |
| Exact Mass | 360.20 |
| IUPAC Name | N-[4-(2-amino-1,3-thiazol-4-yl)phenyl]-3-(heptan-4-ylamino)propanamide |
| SMILES | CCCC(CCC)NCCC(=O)Nc1ccc(-c2csc(N)n2)cc1 |
| InChI | InChI=1S/C19H28N4OS/c1-3-5-15(6-4-2)21-12-11-18(24)22-16-9-7-14(8-10-16)17-13-25-19(20)23-17/h7-10,13,15,21H,3-6,11-12H2,1-2H3,(H2,20,23)(H,22,24) |
| InChIKey | XZHXMCFUWMYIEP-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.53 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |