About 3-(3,5-dimethyl-1-adamantyl)propylazanium
3-(3,5-dimethyl-1-adamantyl)propylazanium (PubChem CID 5276212) has the molecular formula C15H28N+
and a molecular weight of 222.40 g/mol. Its IUPAC name is 3-(3,5-dimethyl-1-adamantyl)propylazanium.
Molecular Properties
| Compound Name | 3-(3,5-dimethyl-1-adamantyl)propylazanium |
| PubChem CID | 5276212 |
| Molecular Formula | C15H28N+ |
| Molecular Weight | 222.40 g/mol |
| Exact Mass | 222.22 |
| IUPAC Name | 3-(3,5-dimethyl-1-adamantyl)propylazanium |
| SMILES | CC12CC3CC(C)(C1)CC(CCC[NH3+])(C3)C2 |
| InChI | InChI=1S/C15H27N/c1-13-6-12-7-14(2,9-13)11-15(8-12,10-13)4-3-5-16/h12H,3-11,16H2,1-2H3/p+1 |
| InChIKey | YNTPYEHKAVNJJC-UHFFFAOYSA-O |
| XLogP | 3.01 |
| TPSA | 27.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.40 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 3-(3,5-dimethyl-1-adamantyl)propylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,5-dimethyl-1-adamantyl)propylazanium?
The IUPAC name of 3-(3,5-dimethyl-1-adamantyl)propylazanium (CID 5276212) is 3-(3,5-dimethyl-1-adamantyl)propylazanium.
What is the SMILES notation for 3-(3,5-dimethyl-1-adamantyl)propylazanium?
The canonical SMILES for 3-(3,5-dimethyl-1-adamantyl)propylazanium is CC12CC3CC(C)(C1)CC(CCC[NH3+])(C3)C2.
What is the InChIKey of 3-(3,5-dimethyl-1-adamantyl)propylazanium?
The InChIKey is YNTPYEHKAVNJJC-UHFFFAOYSA-O. The full InChI is InChI=1S/C15H27N/c1-13-6-12-7-14(2,9-13)11-15(8-12,10-13)4-3-5-16/h12H,3-11,16H2,1-2H3/p+1.
What are the key properties of 3-(3,5-dimethyl-1-adamantyl)propylazanium?
3-(3,5-dimethyl-1-adamantyl)propylazanium has a molecular weight of 222.40 g/mol, XLogP of 3.01, 3 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,5-dimethyl-1-adamantyl)propylazanium is sourced from PubChem (CID 5276212), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).