C15H28N+ — CID 5276212
3-(3,5-dimethyl-1-adamantyl)propylazanium (PubChem CID 5276212) has the molecular formula C15H28N+ and a molecular weight of 222.40 g/mol. Its IUPAC name is 3-(3,5-dimethyl-1-adamantyl)propylazanium.
| Compound Name | 3-(3,5-dimethyl-1-adamantyl)propylazanium |
|---|---|
| PubChem CID | 5276212 |
| Molecular Formula | C15H28N+ |
| Molecular Weight | 222.40 g/mol |
| Exact Mass | 222.22 |
| IUPAC Name | 3-(3,5-dimethyl-1-adamantyl)propylazanium |
| SMILES | CC12CC3CC(C)(C1)CC(CCC[NH3+])(C3)C2 |
| InChI | InChI=1S/C15H27N/c1-13-6-12-7-14(2,9-13)11-15(8-12,10-13)4-3-5-16/h12H,3-11,16H2,1-2H3/p+1 |
| InChIKey | YNTPYEHKAVNJJC-UHFFFAOYSA-O |
| XLogP | 3.01 |
| TPSA | 27.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.40 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |