C12H16NO7P2+ — CID 5276548
[hydroxy(diphosphono)methyl]-(naphthalen-1-ylmethyl)azanium (PubChem CID 5276548) has the molecular formula C12H16NO7P2+ and a molecular weight of 348.21 g/mol. Its IUPAC name is [hydroxy(diphosphono)methyl]-(naphthalen-1-ylmethyl)azanium.
| Compound Name | [hydroxy(diphosphono)methyl]-(naphthalen-1-ylmethyl)azanium |
|---|---|
| PubChem CID | 5276548 |
| Molecular Formula | C12H16NO7P2+ |
| Molecular Weight | 348.21 g/mol |
| Exact Mass | 348.04 |
| IUPAC Name | [hydroxy(diphosphono)methyl]-(naphthalen-1-ylmethyl)azanium |
| SMILES | O=P(O)(O)C(O)([NH2+]Cc1cccc2ccccc12)P(=O)(O)O |
| InChI | InChI=1S/C12H15NO7P2/c14-12(21(15,16)17,22(18,19)20)13-8-10-6-3-5-9-4-1-2-7-11(9)10/h1-7,13-14H,8H2,(H2,15,16,17)(H2,18,19,20)/p+1 |
| InChIKey | LJXYCEVUUHTVGD-UHFFFAOYSA-O |
| XLogP | -0.14 |
| TPSA | 151.90 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.21 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|