C21H15FN4O4 — CID 52766928
2-[[1-(4-fluorophenyl)-5,6-dihydro-4H-cyclopenta[d]pyrazol-3-yl]methyl]-4-nitroisoindole-1,3-dione (PubChem CID 52766928) has the molecular formula C21H15FN4O4 and a molecular weight of 406.37 g/mol. Its IUPAC name is 2-[[1-(4-fluorophenyl)-5,6-dihydro-4H-cyclopenta[d]pyrazol-3-yl]methyl]-4-nitroisoindole-1,3-dione.
| Compound Name | 2-[[1-(4-fluorophenyl)-5,6-dihydro-4H-cyclopenta[d]pyrazol-3-yl]methyl]-4-nitroisoindole-1,3-dione |
|---|---|
| PubChem CID | 52766928 |
| Molecular Formula | C21H15FN4O4 |
| Molecular Weight | 406.37 g/mol |
| Exact Mass | 406.11 |
| IUPAC Name | 2-[[1-(4-fluorophenyl)-5,6-dihydro-4H-cyclopenta[d]pyrazol-3-yl]methyl]-4-nitroisoindole-1,3-dione |
| SMILES | O=C1c2cccc([N+](=O)[O-])c2C(=O)N1Cc1nn(-c2ccc(F)cc2)c2c1CCC2 |
| InChI | InChI=1S/C21H15FN4O4/c22-12-7-9-13(10-8-12)25-17-5-1-3-14(17)16(23-25)11-24-20(27)15-4-2-6-18(26(29)30)19(15)21(24)28/h2,4,6-10H,1,3,5,11H2 |
| InChIKey | SIIRKCYCZABOHA-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 98.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.37 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|