C12H14N4O4 — CID 52826233
butyl 2-(5-oxo-3-pyrimidin-2-yl-1,2,4-oxadiazol-4-yl)acetate (PubChem CID 52826233) has the molecular formula C12H14N4O4 and a molecular weight of 278.27 g/mol. Its IUPAC name is butyl 2-(5-oxo-3-pyrimidin-2-yl-1,2,4-oxadiazol-4-yl)acetate.
| Compound Name | butyl 2-(5-oxo-3-pyrimidin-2-yl-1,2,4-oxadiazol-4-yl)acetate |
|---|---|
| PubChem CID | 52826233 |
| Molecular Formula | C12H14N4O4 |
| Molecular Weight | 278.27 g/mol |
| Exact Mass | 278.10 |
| IUPAC Name | butyl 2-(5-oxo-3-pyrimidin-2-yl-1,2,4-oxadiazol-4-yl)acetate |
| SMILES | CCCCOC(=O)Cn1c(-c2ncccn2)noc1=O |
| InChI | InChI=1S/C12H14N4O4/c1-2-3-7-19-9(17)8-16-11(15-20-12(16)18)10-13-5-4-6-14-10/h4-6H,2-3,7-8H2,1H3 |
| InChIKey | MEZQOXDZHMLWEV-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 100.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.27 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|