C24H18ClN3OS2 — CID 5290147
(5Z)-5-(5-chloro-3-ethyl-1,3-benzothiazol-2-ylidene)-2-(N-phenylanilino)-1,3-thiazol-4-one (PubChem CID 5290147) has the molecular formula C24H18ClN3OS2 and a molecular weight of 464.02 g/mol. Its IUPAC name is (5Z)-5-(5-chloro-3-ethyl-1,3-benzothiazol-2-ylidene)-2-(N-phenylanilino)-1,3-thiazol-4-one.
| Compound Name | (5Z)-5-(5-chloro-3-ethyl-1,3-benzothiazol-2-ylidene)-2-(N-phenylanilino)-1,3-thiazol-4-one |
|---|---|
| PubChem CID | 5290147 |
| Molecular Formula | C24H18ClN3OS2 |
| Molecular Weight | 464.02 g/mol |
| Exact Mass | 463.06 |
| IUPAC Name | (5Z)-5-(5-chloro-3-ethyl-1,3-benzothiazol-2-ylidene)-2-(N-phenylanilino)-1,3-thiazol-4-one |
| SMILES | CCN1/C(=C2/SC(N(c3ccccc3)c3ccccc3)=NC2=O)Sc2ccc(Cl)cc21 |
| InChI | InChI=1S/C24H18ClN3OS2/c1-2-27-19-15-16(25)13-14-20(19)30-23(27)21-22(29)26-24(31-21)28(17-9-5-3-6-10-17)18-11-7-4-8-12-18/h3-15H,2H2,1H3/b23-21- |
| InChIKey | UBLXZMMNJCSOIG-LNVKXUELSA-N |
| XLogP | 6.91 |
| TPSA | 35.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.02 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|