C7H15NS2 — CID 529054
2-ethyl-4,6-dimethyl-1,3,5-dithiazinane (PubChem CID 529054) has the molecular formula C7H15NS2 and a molecular weight of 177.34 g/mol. Its IUPAC name is 2-ethyl-4,6-dimethyl-1,3,5-dithiazinane.
| Compound Name | 2-ethyl-4,6-dimethyl-1,3,5-dithiazinane |
|---|---|
| PubChem CID | 529054 |
| Molecular Formula | C7H15NS2 |
| Molecular Weight | 177.34 g/mol |
| Exact Mass | 177.06 |
| IUPAC Name | 2-ethyl-4,6-dimethyl-1,3,5-dithiazinane |
| SMILES | CCC1SC(C)NC(C)S1 |
| InChI | InChI=1S/C7H15NS2/c1-4-7-9-5(2)8-6(3)10-7/h5-8H,4H2,1-3H3 |
| InChIKey | BHTMBVSWSZTUBT-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.34 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |