C8H17NS2 — CID 529052
2,4-dimethyl-6-propan-2-yl-1,3,5-dithiazinane (PubChem CID 529052) has the molecular formula C8H17NS2 and a molecular weight of 191.36 g/mol. Its IUPAC name is 2,4-dimethyl-6-propan-2-yl-1,3,5-dithiazinane.
| Compound Name | 2,4-dimethyl-6-propan-2-yl-1,3,5-dithiazinane |
|---|---|
| PubChem CID | 529052 |
| Molecular Formula | C8H17NS2 |
| Molecular Weight | 191.36 g/mol |
| Exact Mass | 191.08 |
| IUPAC Name | 2,4-dimethyl-6-propan-2-yl-1,3,5-dithiazinane |
| SMILES | CC1NC(C(C)C)SC(C)S1 |
| InChI | InChI=1S/C8H17NS2/c1-5(2)8-9-6(3)10-7(4)11-8/h5-9H,1-4H3 |
| InChIKey | NOOYZCFJVKLILW-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.36 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |