C9H19NS2 — CID 529058
4-butyl-2,6-dimethyl-1,3,5-dithiazinane (PubChem CID 529058) has the molecular formula C9H19NS2 and a molecular weight of 205.39 g/mol. Its IUPAC name is 4-butyl-2,6-dimethyl-1,3,5-dithiazinane.
| Compound Name | 4-butyl-2,6-dimethyl-1,3,5-dithiazinane |
|---|---|
| PubChem CID | 529058 |
| Molecular Formula | C9H19NS2 |
| Molecular Weight | 205.39 g/mol |
| Exact Mass | 205.10 |
| IUPAC Name | 4-butyl-2,6-dimethyl-1,3,5-dithiazinane |
| SMILES | CCCCC1NC(C)SC(C)S1 |
| InChI | InChI=1S/C9H19NS2/c1-4-5-6-9-10-7(2)11-8(3)12-9/h7-10H,4-6H2,1-3H3 |
| InChIKey | ZGCDSMJNRUXZGG-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.39 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |