C26H30N2O8S — CID 52918095
(2S,5R,6R)-6-[1-hydroxy-2-[2-(4-phenylphenyl)propan-2-yloxycarbonylamino]ethyl]-3,3-dimethyl-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid (PubChem CID 52918095) has the molecular formula C26H30N2O8S and a molecular weight of 530.60 g/mol. Its IUPAC name is (2S,5R,6R)-6-[1-hydroxy-2-[2-(4-phenylphenyl)propan-2-yloxycarbonylamino]ethyl]-3,3-dimethyl-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid.
| Compound Name | (2S,5R,6R)-6-[1-hydroxy-2-[2-(4-phenylphenyl)propan-2-yloxycarbonylamino]ethyl]-3,3-dimethyl-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
|---|---|
| PubChem CID | 52918095 |
| Molecular Formula | C26H30N2O8S |
| Molecular Weight | 530.60 g/mol |
| Exact Mass | 530.17 |
| IUPAC Name | (2S,5R,6R)-6-[1-hydroxy-2-[2-(4-phenylphenyl)propan-2-yloxycarbonylamino]ethyl]-3,3-dimethyl-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
| SMILES | CC(C)(OC(=O)NCC(O)[C@@H]1C(=O)N2[C@@H](C(=O)O)C(C)(C)S(=O)(=O)[C@H]12)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C26H30N2O8S/c1-25(2,17-12-10-16(11-13-17)15-8-6-5-7-9-15)36-24(33)27-14-18(29)19-21(30)28-20(23(31)32)26(3,4)37(34,35)22(19)28/h5-13,18-20,22,29H,14H2,1-4H3,(H,27,33)(H,31,32)/t18?,19-,20+,22-/m1/s1 |
| InChIKey | USRCKXNHLZSBBE-RKKYOWQMSA-N |
| XLogP | 2.12 |
| TPSA | 150.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.60 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |